C19H19F3N6O4 — CID 129230298
2-[[1-[3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]-1-nitroguanidine (PubChem CID 129230298) has the molecular formula C19H19F3N6O4 and a molecular weight of 452.39 g/mol. Its IUPAC name is 2-[[1-[3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]-1-nitroguanidine.
| Compound Name | 2-[[1-[3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]-1-nitroguanidine |
|---|---|
| PubChem CID | 129230298 |
| Molecular Formula | C19H19F3N6O4 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 2-[[1-[3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]-1-nitroguanidine |
| SMILES | Cc1ccc(Nc2c(C(=O)N3CC(O)(C/N=C(\N)N[N+](=O)[O-])C3)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C19H19F3N6O4/c1-10-2-5-14(13(21)6-10)25-16-11(3-4-12(20)15(16)22)17(29)27-8-19(30,9-27)7-24-18(23)26-28(31)32/h2-6,25,30H,7-9H2,1H3,(H3,23,24,26) |
| InChIKey | PIRSUJPDFSEUDI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|