C19H16F3IN6O2 — CID 59469096
1-cyano-2-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]guanidine (PubChem CID 59469096) has the molecular formula C19H16F3IN6O2 and a molecular weight of 544.28 g/mol. Its IUPAC name is 1-cyano-2-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]guanidine.
| Compound Name | 1-cyano-2-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 59469096 |
| Molecular Formula | C19H16F3IN6O2 |
| Molecular Weight | 544.28 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | 1-cyano-2-[[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]methyl]guanidine |
| SMILES | N#CN/C(N)=N/CC1(O)CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C19H16F3IN6O2/c20-12-3-2-11(16(15(12)22)28-14-4-1-10(23)5-13(14)21)17(30)29-7-19(31,8-29)6-26-18(25)27-9-24/h1-5,28,31H,6-8H2,(H3,25,26,27) |
| InChIKey | SSKPIHOBPSOSEN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|