C28H29F3IN3O2 — CID 163597335
[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[[[(1R,3R,5R,7R)-2-tetracyclo[5.3.1.03,9.05,9]undecanyl]amino]methyl]azetidin-1-yl]methanone (PubChem CID 163597335) has the molecular formula C28H29F3IN3O2 and a molecular weight of 623.46 g/mol. Its IUPAC name is [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[[[(1R,3R,5R,7R)-2-tetracyclo[5.3.1.03,9.05,9]undecanyl]amino]methyl]azetidin-1-yl]methanone.
| Compound Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[[[(1R,3R,5R,7R)-2-tetracyclo[5.3.1.03,9.05,9]undecanyl]amino]methyl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 163597335 |
| Molecular Formula | C28H29F3IN3O2 |
| Molecular Weight | 623.46 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[[[(1R,3R,5R,7R)-2-tetracyclo[5.3.1.03,9.05,9]undecanyl]amino]methyl]azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(O)(CNC2[C@@H]3C[C@H]4C[C@@H]5C[C@@H]2C5(C4)C3)C1 |
| InChI | InChI=1S/C28H29F3IN3O2/c29-20-3-2-18(25(23(20)31)34-22-4-1-17(32)8-21(22)30)26(36)35-12-27(37,13-35)11-33-24-15-5-14-6-16-7-19(24)28(16,9-14)10-15/h1-4,8,14-16,19,24,33-34,37H,5-7,9-13H2/t14-,15+,16+,19-,24?,28?/m0/s1 |
| InChIKey | GUOQPQSYYFKTHZ-SUUPVFCHSA-N |
| XLogP | 5.05 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|