C46H46F6I2N6O8 — CID 175892848
(E)-but-2-enedioic acid;bis([3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-1-ylazetidin-1-yl)methanone) (PubChem CID 175892848) has the molecular formula C46H46F6I2N6O8 and a molecular weight of 1178.70 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis([3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-1-ylazetidin-1-yl)methanone).
| Compound Name | (E)-but-2-enedioic acid;bis([3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-1-ylazetidin-1-yl)methanone) |
|---|---|
| PubChem CID | 175892848 |
| Molecular Formula | C46H46F6I2N6O8 |
| Molecular Weight | 1178.70 g/mol |
| Exact Mass | 1178.14 |
| IUPAC Name | (E)-but-2-enedioic acid;bis([3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-1-ylazetidin-1-yl)methanone) |
| SMILES | O=C(O)/C=C/C(=O)O.O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(O)(N2CCCCC2)C1.O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(O)(N2CCCCC2)C1 |
| InChI | InChI=1S/2C21H21F3IN3O2.C4H4O4/c2*22-15-6-5-14(19(18(15)24)26-17-7-4-13(25)10-16(17)23)20(29)27-11-21(30,12-27)28-8-2-1-3-9-28;5-3(6)1-2-4(7)8/h2*4-7,10,26,30H,1-3,8-9,11-12H2;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | LLWOQJRVGANMPI-WXXKFALUSA-N |
| XLogP | 7.88 |
| TPSA | 186.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1178.70 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|