C27H31F3IN3O4 — CID 174985868
tert-butyl N-cyclohexyl-N-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]carbamate (PubChem CID 174985868) has the molecular formula C27H31F3IN3O4 and a molecular weight of 645.46 g/mol. Its IUPAC name is tert-butyl N-cyclohexyl-N-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-cyclohexyl-N-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 174985868 |
| Molecular Formula | C27H31F3IN3O4 |
| Molecular Weight | 645.46 g/mol |
| Exact Mass | 645.13 |
| IUPAC Name | tert-butyl N-cyclohexyl-N-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-hydroxyazetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C1CCCCC1)C1(O)CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C27H31F3IN3O4/c1-26(2,3)38-25(36)34(17-7-5-4-6-8-17)27(37)14-33(15-27)24(35)18-10-11-19(28)22(30)23(18)32-21-12-9-16(31)13-20(21)29/h9-13,17,32,37H,4-8,14-15H2,1-3H3 |
| InChIKey | FCDYEKYTPZRYBE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|