C22H28F3N5O2 — CID 143702209
[3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-hydroxyazetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-methylanilino)phenyl]methanone;ethane (PubChem CID 143702209) has the molecular formula C22H28F3N5O2 and a molecular weight of 451.49 g/mol. Its IUPAC name is [3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-hydroxyazetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-methylanilino)phenyl]methanone;ethane.
| Compound Name | [3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-hydroxyazetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-methylanilino)phenyl]methanone;ethane |
|---|---|
| PubChem CID | 143702209 |
| Molecular Formula | C22H28F3N5O2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | [3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-hydroxyazetidin-1-yl]-[3,4-difluoro-2-(2-fluoro-4-methylanilino)phenyl]methanone;ethane |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)N3CC(O)(CN(N)/C=C\N)C3)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C20H22F3N5O2.C2H6/c1-12-2-5-16(15(22)8-12)26-18-13(3-4-14(21)17(18)23)19(29)27-9-20(30,10-27)11-28(25)7-6-24;1-2/h2-8,26,30H,9-11,24-25H2,1H3;1-2H3/b7-6-; |
| InChIKey | TYXKZGXNVNTSQY-NAFXZHHSSA-N |
| XLogP | 2.97 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|