C24H27F3IN3O4 — CID 68808117
[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[(2-propoxyethylamino)methyl]azetidin-3-yl] acetate (PubChem CID 68808117) has the molecular formula C24H27F3IN3O4 and a molecular weight of 605.40 g/mol. Its IUPAC name is [1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[(2-propoxyethylamino)methyl]azetidin-3-yl] acetate.
| Compound Name | [1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[(2-propoxyethylamino)methyl]azetidin-3-yl] acetate |
|---|---|
| PubChem CID | 68808117 |
| Molecular Formula | C24H27F3IN3O4 |
| Molecular Weight | 605.40 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | [1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[(2-propoxyethylamino)methyl]azetidin-3-yl] acetate |
| SMILES | CCCOCCNCC1(OC(C)=O)CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C24H27F3IN3O4/c1-3-9-34-10-8-29-12-24(35-15(2)32)13-31(14-24)23(33)17-5-6-18(25)21(27)22(17)30-20-7-4-16(28)11-19(20)26/h4-7,11,29-30H,3,8-10,12-14H2,1-2H3 |
| InChIKey | JPXXLWXSSHYJGY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|