C28H27F3IN3O3 — CID 67051753
[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[[2-(4-methylphenyl)ethylamino]methyl]azetidin-3-yl] acetate (PubChem CID 67051753) has the molecular formula C28H27F3IN3O3 and a molecular weight of 637.44 g/mol. Its IUPAC name is [1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[[2-(4-methylphenyl)ethylamino]methyl]azetidin-3-yl] acetate.
| Compound Name | [1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[[2-(4-methylphenyl)ethylamino]methyl]azetidin-3-yl] acetate |
|---|---|
| PubChem CID | 67051753 |
| Molecular Formula | C28H27F3IN3O3 |
| Molecular Weight | 637.44 g/mol |
| Exact Mass | 637.10 |
| IUPAC Name | [1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[[2-(4-methylphenyl)ethylamino]methyl]azetidin-3-yl] acetate |
| SMILES | CC(=O)OC1(CNCCc2ccc(C)cc2)CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C28H27F3IN3O3/c1-17-3-5-19(6-4-17)11-12-33-14-28(38-18(2)36)15-35(16-28)27(37)21-8-9-22(29)25(31)26(21)34-24-10-7-20(32)13-23(24)30/h3-10,13,33-34H,11-12,14-16H2,1-2H3 |
| InChIKey | AYFFALNUVWBQEL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|