C26H24F3IN4O3 — CID 67051653
[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[(2-pyridin-3-ylethylamino)methyl]azetidin-3-yl] acetate (PubChem CID 67051653) has the molecular formula C26H24F3IN4O3 and a molecular weight of 624.40 g/mol. Its IUPAC name is [1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[(2-pyridin-3-ylethylamino)methyl]azetidin-3-yl] acetate.
| Compound Name | [1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[(2-pyridin-3-ylethylamino)methyl]azetidin-3-yl] acetate |
|---|---|
| PubChem CID | 67051653 |
| Molecular Formula | C26H24F3IN4O3 |
| Molecular Weight | 624.40 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | [1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-3-[(2-pyridin-3-ylethylamino)methyl]azetidin-3-yl] acetate |
| SMILES | CC(=O)OC1(CNCCc2cccnc2)CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C26H24F3IN4O3/c1-16(35)37-26(13-32-10-8-17-3-2-9-31-12-17)14-34(15-26)25(36)19-5-6-20(27)23(29)24(19)33-22-7-4-18(30)11-21(22)28/h2-7,9,11-12,32-33H,8,10,13-15H2,1H3 |
| InChIKey | QZIMXBGNGQZBPP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|