C29H30F3IN4O3 — CID 68820190
[2-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-1,2-diethyl-3-(2-pyridin-3-ylethylamino)azetidin-3-yl] acetate (PubChem CID 68820190) has the molecular formula C29H30F3IN4O3 and a molecular weight of 666.48 g/mol. Its IUPAC name is [2-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-1,2-diethyl-3-(2-pyridin-3-ylethylamino)azetidin-3-yl] acetate.
| Compound Name | [2-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-1,2-diethyl-3-(2-pyridin-3-ylethylamino)azetidin-3-yl] acetate |
|---|---|
| PubChem CID | 68820190 |
| Molecular Formula | C29H30F3IN4O3 |
| Molecular Weight | 666.48 g/mol |
| Exact Mass | 666.13 |
| IUPAC Name | [2-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-1,2-diethyl-3-(2-pyridin-3-ylethylamino)azetidin-3-yl] acetate |
| SMILES | CCN1CC(NCCc2cccnc2)(OC(C)=O)C1(CC)C(=O)c1ccc(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C29H30F3IN4O3/c1-4-28(29(40-18(3)38,17-37(28)5-2)35-14-12-19-7-6-13-34-16-19)27(39)21-9-10-22(30)25(32)26(21)36-24-11-8-20(33)15-23(24)31/h6-11,13,15-16,35-36H,4-5,12,14,17H2,1-3H3 |
| InChIKey | VMOKZVDVWPTJHG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|