C21H21F3IN3O3 — CID 57448422
1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-N-ethyl-N-(2-hydroxyethyl)azetidine-3-carboxamide (PubChem CID 57448422) has the molecular formula C21H21F3IN3O3 and a molecular weight of 547.32 g/mol. Its IUPAC name is 1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-N-ethyl-N-(2-hydroxyethyl)azetidine-3-carboxamide.
| Compound Name | 1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-N-ethyl-N-(2-hydroxyethyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 57448422 |
| Molecular Formula | C21H21F3IN3O3 |
| Molecular Weight | 547.32 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | 1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-N-ethyl-N-(2-hydroxyethyl)azetidine-3-carboxamide |
| SMILES | CCN(CCO)C(=O)C1CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C21H21F3IN3O3/c1-2-27(7-8-29)20(30)12-10-28(11-12)21(31)14-4-5-15(22)18(24)19(14)26-17-6-3-13(25)9-16(17)23/h3-6,9,12,26,29H,2,7-8,10-11H2,1H3 |
| InChIKey | ZDIUOGXBJFHSPF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|