C22H24F3IN4O4 — CID 69104005
1-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]-3-(4,4-dihydroxybutyl)-1-methylurea (PubChem CID 69104005) has the molecular formula C22H24F3IN4O4 and a molecular weight of 592.36 g/mol. Its IUPAC name is 1-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]-3-(4,4-dihydroxybutyl)-1-methylurea.
| Compound Name | 1-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]-3-(4,4-dihydroxybutyl)-1-methylurea |
|---|---|
| PubChem CID | 69104005 |
| Molecular Formula | C22H24F3IN4O4 |
| Molecular Weight | 592.36 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | 1-[1-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]azetidin-3-yl]-3-(4,4-dihydroxybutyl)-1-methylurea |
| SMILES | CN(C(=O)NCCCC(O)O)C1CN(C(=O)c2ccc(F)c(F)c2Nc2ccc(I)cc2F)C1 |
| InChI | InChI=1S/C22H24F3IN4O4/c1-29(22(34)27-8-2-3-18(31)32)13-10-30(11-13)21(33)14-5-6-15(23)19(25)20(14)28-17-7-4-12(26)9-16(17)24/h4-7,9,13,18,28,31-32H,2-3,8,10-11H2,1H3,(H,27,34) |
| InChIKey | MRCMJEMZTVRBFE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|