C20H20F3IN4O — CID 68513262
[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-piperazin-2-ylazetidin-1-yl)methanone (PubChem CID 68513262) has the molecular formula C20H20F3IN4O and a molecular weight of 516.31 g/mol. Its IUPAC name is [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-piperazin-2-ylazetidin-1-yl)methanone.
| Compound Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-piperazin-2-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 68513262 |
| Molecular Formula | C20H20F3IN4O |
| Molecular Weight | 516.31 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-piperazin-2-ylazetidin-1-yl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N1CC(C2CNCCN2)C1 |
| InChI | InChI=1S/C20H20F3IN4O/c21-14-3-2-13(19(18(14)23)27-16-4-1-12(24)7-15(16)22)20(29)28-9-11(10-28)17-8-25-5-6-26-17/h1-4,7,11,17,25-27H,5-6,8-10H2 |
| InChIKey | DRVFVIZZGQGABS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|