C21H22F2IN3O — CID 141178688
[3-fluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-[(2S)-piperidin-2-yl]azetidin-1-yl]methanone (PubChem CID 141178688) has the molecular formula C21H22F2IN3O and a molecular weight of 497.33 g/mol. Its IUPAC name is [3-fluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-[(2S)-piperidin-2-yl]azetidin-1-yl]methanone.
| Compound Name | [3-fluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-[(2S)-piperidin-2-yl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 141178688 |
| Molecular Formula | C21H22F2IN3O |
| Molecular Weight | 497.33 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | [3-fluoro-2-(2-fluoro-4-iodoanilino)phenyl]-[3-[(2S)-piperidin-2-yl]azetidin-1-yl]methanone |
| SMILES | O=C(c1cccc(F)c1Nc1ccc(I)cc1F)N1CC([C@@H]2CCCCN2)C1 |
| InChI | InChI=1S/C21H22F2IN3O/c22-16-5-3-4-15(20(16)26-19-8-7-14(24)10-17(19)23)21(28)27-11-13(12-27)18-6-1-2-9-25-18/h3-5,7-8,10,13,18,25-26H,1-2,6,9,11-12H2/t18-/m0/s1 |
| InChIKey | KOXLPFOVLOFYQM-SFHVURJKSA-N |
| XLogP | 4.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|