C21H23FIN3O2 — CID 166640206
[2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[(2R)-piperidin-2-yl]azetidin-1-yl]methanone (PubChem CID 166640206) has the molecular formula C21H23FIN3O2 and a molecular weight of 495.34 g/mol. Its IUPAC name is [2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[(2R)-piperidin-2-yl]azetidin-1-yl]methanone.
| Compound Name | [2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[(2R)-piperidin-2-yl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 166640206 |
| Molecular Formula | C21H23FIN3O2 |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | [2-(2-fluoro-4-iodoanilino)phenyl]-[3-hydroxy-3-[(2R)-piperidin-2-yl]azetidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Nc1ccc(I)cc1F)N1CC(O)([C@H]2CCCCN2)C1 |
| InChI | InChI=1S/C21H23FIN3O2/c22-16-11-14(23)8-9-18(16)25-17-6-2-1-5-15(17)20(27)26-12-21(28,13-26)19-7-3-4-10-24-19/h1-2,5-6,8-9,11,19,24-25,28H,3-4,7,10,12-13H2/t19-/m1/s1 |
| InChIKey | YZPSXSZMPVMUTG-LJQANCHMSA-N |
| XLogP | 3.50 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|