C21H22F2IN3O2 — CID 69102499
[3-fluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-2-ylazetidin-1-yl)methanone (PubChem CID 69102499) has the molecular formula C21H22F2IN3O2 and a molecular weight of 513.33 g/mol. Its IUPAC name is [3-fluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-2-ylazetidin-1-yl)methanone.
| Compound Name | [3-fluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-2-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 69102499 |
| Molecular Formula | C21H22F2IN3O2 |
| Molecular Weight | 513.33 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | [3-fluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-2-ylazetidin-1-yl)methanone |
| SMILES | O=C(c1cccc(F)c1Nc1ccc(I)cc1F)N1CC(O)(C2CCCCN2)C1 |
| InChI | InChI=1S/C21H22F2IN3O2/c22-15-5-3-4-14(19(15)26-17-8-7-13(24)10-16(17)23)20(28)27-11-21(29,12-27)18-6-1-2-9-25-18/h3-5,7-8,10,18,25-26,29H,1-2,6,9,11-12H2 |
| InChIKey | ZBUWGJXWWFFEIM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|