C20H20F2IN3O2 — CID 58222297
[2-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-[3-hydroxy-3-[(2S)-pyrrolidin-2-yl]azetidin-1-yl]methanone (PubChem CID 58222297) has the molecular formula C20H20F2IN3O2 and a molecular weight of 499.30 g/mol. Its IUPAC name is [2-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-[3-hydroxy-3-[(2S)-pyrrolidin-2-yl]azetidin-1-yl]methanone.
| Compound Name | [2-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-[3-hydroxy-3-[(2S)-pyrrolidin-2-yl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 58222297 |
| Molecular Formula | C20H20F2IN3O2 |
| Molecular Weight | 499.30 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | [2-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-[3-hydroxy-3-[(2S)-pyrrolidin-2-yl]azetidin-1-yl]methanone |
| SMILES | O=C(c1ccnc(F)c1Cc1ccc(I)cc1F)N1CC(O)([C@@H]2CCCN2)C1 |
| InChI | InChI=1S/C20H20F2IN3O2/c21-16-9-13(23)4-3-12(16)8-15-14(5-7-25-18(15)22)19(27)26-10-20(28,11-26)17-2-1-6-24-17/h3-5,7,9,17,24,28H,1-2,6,8,10-11H2/t17-/m0/s1 |
| InChIKey | DWUAXKTWXCIKQB-KRWDZBQOSA-N |
| XLogP | 2.49 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|