C20H22F2N4O2 — CID 129230479
[2-fluoro-3-(2-fluoro-4-methylanilino)-4-pyridinyl]-[3-hydroxy-3-[(2S)-pyrrolidin-2-yl]azetidin-1-yl]methanone (PubChem CID 129230479) has the molecular formula C20H22F2N4O2 and a molecular weight of 388.42 g/mol. Its IUPAC name is [2-fluoro-3-(2-fluoro-4-methylanilino)-4-pyridinyl]-[3-hydroxy-3-[(2S)-pyrrolidin-2-yl]azetidin-1-yl]methanone.
| Compound Name | [2-fluoro-3-(2-fluoro-4-methylanilino)-4-pyridinyl]-[3-hydroxy-3-[(2S)-pyrrolidin-2-yl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 129230479 |
| Molecular Formula | C20H22F2N4O2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [2-fluoro-3-(2-fluoro-4-methylanilino)-4-pyridinyl]-[3-hydroxy-3-[(2S)-pyrrolidin-2-yl]azetidin-1-yl]methanone |
| SMILES | Cc1ccc(Nc2c(C(=O)N3CC(O)([C@@H]4CCCN4)C3)ccnc2F)c(F)c1 |
| InChI | InChI=1S/C20H22F2N4O2/c1-12-4-5-15(14(21)9-12)25-17-13(6-8-24-18(17)22)19(27)26-10-20(28,11-26)16-3-2-7-23-16/h4-6,8-9,16,23,25,28H,2-3,7,10-11H2,1H3/t16-/m0/s1 |
| InChIKey | FUCCBTJGXXWOSS-INIZCTEOSA-N |
| XLogP | 2.35 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|