C17H13F3IN3O3 — CID 87589073
N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-N-hydroxyazetidine-3-carboxamide (PubChem CID 87589073) has the molecular formula C17H13F3IN3O3 and a molecular weight of 491.21 g/mol. Its IUPAC name is N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-N-hydroxyazetidine-3-carboxamide.
| Compound Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-N-hydroxyazetidine-3-carboxamide |
|---|---|
| PubChem CID | 87589073 |
| Molecular Formula | C17H13F3IN3O3 |
| Molecular Weight | 491.21 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoyl]-N-hydroxyazetidine-3-carboxamide |
| SMILES | O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N(O)C(=O)C1CNC1 |
| InChI | InChI=1S/C17H13F3IN3O3/c18-11-3-2-10(17(26)24(27)16(25)8-6-22-7-8)15(14(11)20)23-13-4-1-9(21)5-12(13)19/h1-5,8,22-23,27H,6-7H2 |
| InChIKey | HESKHFRLKKPLJA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|