C24H22F4IN3O2 — CID 143702227
3,4-difluoro-N-[3-(3-fluoroanilino)propyl]-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)benzamide (PubChem CID 143702227) has the molecular formula C24H22F4IN3O2 and a molecular weight of 587.36 g/mol. Its IUPAC name is 3,4-difluoro-N-[3-(3-fluoroanilino)propyl]-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3,4-difluoro-N-[3-(3-fluoroanilino)propyl]-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 143702227 |
| Molecular Formula | C24H22F4IN3O2 |
| Molecular Weight | 587.36 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | 3,4-difluoro-N-[3-(3-fluoroanilino)propyl]-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)N(CCO)CCCNc1cccc(F)c1 |
| InChI | InChI=1S/C24H22F4IN3O2/c25-15-3-1-4-17(13-15)30-9-2-10-32(11-12-33)24(34)18-6-7-19(26)22(28)23(18)31-21-8-5-16(29)14-20(21)27/h1,3-8,13-14,30-31,33H,2,9-12H2 |
| InChIKey | YYMOCMRIMWSNAJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|