C17H15FIN2O2+ — CID 71210840
4-fluoro-5-(4-iodo-2-methylanilino)-1-methyl-3H-indol-1-ium-6-carboxylic acid (PubChem CID 71210840) has the molecular formula C17H15FIN2O2+ and a molecular weight of 425.22 g/mol. Its IUPAC name is 4-fluoro-5-(4-iodo-2-methylanilino)-1-methyl-3H-indol-1-ium-6-carboxylic acid.
| Compound Name | 4-fluoro-5-(4-iodo-2-methylanilino)-1-methyl-3H-indol-1-ium-6-carboxylic acid |
|---|---|
| PubChem CID | 71210840 |
| Molecular Formula | C17H15FIN2O2+ |
| Molecular Weight | 425.22 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 4-fluoro-5-(4-iodo-2-methylanilino)-1-methyl-3H-indol-1-ium-6-carboxylic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(C(=O)O)cc2c(c1F)CC=[N+]2C |
| InChI | InChI=1S/C17H14FIN2O2/c1-9-7-10(19)3-4-13(9)20-16-12(17(22)23)8-14-11(15(16)18)5-6-21(14)2/h3-4,6-8,20H,5H2,1-2H3/p+1 |
| InChIKey | FYFNLMFZGPQCQW-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 52.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|