C18H18F3IN2O3S — CID 163679019
N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)-6-methoxy-5-methylphenyl]cyclobutanesulfonamide (PubChem CID 163679019) has the molecular formula C18H18F3IN2O3S and a molecular weight of 526.32 g/mol. Its IUPAC name is N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)-6-methoxy-5-methylphenyl]cyclobutanesulfonamide.
| Compound Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)-6-methoxy-5-methylphenyl]cyclobutanesulfonamide |
|---|---|
| PubChem CID | 163679019 |
| Molecular Formula | C18H18F3IN2O3S |
| Molecular Weight | 526.32 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)-6-methoxy-5-methylphenyl]cyclobutanesulfonamide |
| SMILES | COc1c(C)c(F)c(F)c(Nc2ccc(I)cc2F)c1NS(=O)(=O)C1CCC1 |
| InChI | InChI=1S/C18H18F3IN2O3S/c1-9-14(20)15(21)16(23-13-7-6-10(22)8-12(13)19)17(18(9)27-2)24-28(25,26)11-4-3-5-11/h6-8,11,23-24H,3-5H2,1-2H3 |
| InChIKey | JJFRUQFEUNWORH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|