C16H14F3IN2O2S — CID 53492153
N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-methylcyclopropanesulfonamide (PubChem CID 53492153) has the molecular formula C16H14F3IN2O2S and a molecular weight of 482.27 g/mol. Its IUPAC name is N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-methylcyclopropanesulfonamide.
| Compound Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-methylcyclopropanesulfonamide |
|---|---|
| PubChem CID | 53492153 |
| Molecular Formula | C16H14F3IN2O2S |
| Molecular Weight | 482.27 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-N-methylcyclopropanesulfonamide |
| SMILES | CN(c1ccc(F)c(F)c1Nc1ccc(I)cc1F)S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C16H14F3IN2O2S/c1-22(25(23,24)10-3-4-10)14-7-5-11(17)15(19)16(14)21-13-6-2-9(20)8-12(13)18/h2,5-8,10,21H,3-4H2,1H3 |
| InChIKey | XSPQMZQPXNTOOE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|