C18H14F3IN2O3S — CID 53492157
N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-2,5-dimethylfuran-3-sulfonamide (PubChem CID 53492157) has the molecular formula C18H14F3IN2O3S and a molecular weight of 522.29 g/mol. Its IUPAC name is N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-2,5-dimethylfuran-3-sulfonamide.
| Compound Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-2,5-dimethylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 53492157 |
| Molecular Formula | C18H14F3IN2O3S |
| Molecular Weight | 522.29 g/mol |
| Exact Mass | 521.97 |
| IUPAC Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-2,5-dimethylfuran-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(F)c(F)c2Nc2ccc(I)cc2F)c(C)o1 |
| InChI | InChI=1S/C18H14F3IN2O3S/c1-9-7-16(10(2)27-9)28(25,26)24-15-6-4-12(19)17(21)18(15)23-14-5-3-11(22)8-13(14)20/h3-8,23-24H,1-2H3 |
| InChIKey | AOCWYPLAWSBNRY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.29 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|