C16H15F4NO — CID 171642357
3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoyl fluoride;ethane (PubChem CID 171642357) has the molecular formula C16H15F4NO and a molecular weight of 313.29 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoyl fluoride;ethane.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoyl fluoride;ethane |
|---|---|
| PubChem CID | 171642357 |
| Molecular Formula | C16H15F4NO |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoyl fluoride;ethane |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)F)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C14H9F4NO.C2H6/c1-7-2-5-11(10(16)6-7)19-13-8(14(18)20)3-4-9(15)12(13)17;1-2/h2-6,19H,1H3;1-2H3 |
| InChIKey | RBGYWJDLSGCRKQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|