C18H17F3N2O4 — CID 170207894
[2-hydroxy-3-(methylideneamino)oxypropyl] 3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoate (PubChem CID 170207894) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is [2-hydroxy-3-(methylideneamino)oxypropyl] 3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoate.
| Compound Name | [2-hydroxy-3-(methylideneamino)oxypropyl] 3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoate |
|---|---|
| PubChem CID | 170207894 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [2-hydroxy-3-(methylideneamino)oxypropyl] 3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoate |
| SMILES | C=NOCC(O)COC(=O)c1ccc(F)c(F)c1Nc1ccc(C)cc1F |
| InChI | InChI=1S/C18H17F3N2O4/c1-10-3-6-15(14(20)7-10)23-17-12(4-5-13(19)16(17)21)18(25)26-8-11(24)9-27-22-2/h3-7,11,23-24H,2,8-9H2,1H3 |
| InChIKey | AGTQJUVUTNZABP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|