C17H20F3N3O2 — CID 143173019
3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[(hydroxyamino)methyl]benzamide;ethane (PubChem CID 143173019) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[(hydroxyamino)methyl]benzamide;ethane.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[(hydroxyamino)methyl]benzamide;ethane |
|---|---|
| PubChem CID | 143173019 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[(hydroxyamino)methyl]benzamide;ethane |
| SMILES | CC.Cc1ccc(Nc2c(C(N)=O)cc(CNO)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C15H14F3N3O2.C2H6/c1-7-2-3-11(10(16)4-7)21-14-9(15(19)22)5-8(6-20-23)12(17)13(14)18;1-2/h2-5,20-21,23H,6H2,1H3,(H2,19,22);1-2H3 |
| InChIKey | UTECYKDSBGZVDA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|