C21H21F3N2O6 — CID 166677751
methyl 5-[[(2-acetyloxyacetyl)-methoxyamino]methyl]-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoate (PubChem CID 166677751) has the molecular formula C21H21F3N2O6 and a molecular weight of 454.40 g/mol. Its IUPAC name is methyl 5-[[(2-acetyloxyacetyl)-methoxyamino]methyl]-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoate.
| Compound Name | methyl 5-[[(2-acetyloxyacetyl)-methoxyamino]methyl]-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoate |
|---|---|
| PubChem CID | 166677751 |
| Molecular Formula | C21H21F3N2O6 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | methyl 5-[[(2-acetyloxyacetyl)-methoxyamino]methyl]-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzoate |
| SMILES | COC(=O)c1cc(CN(OC)C(=O)COC(C)=O)c(F)c(F)c1Nc1ccc(C)cc1F |
| InChI | InChI=1S/C21H21F3N2O6/c1-11-5-6-16(15(22)7-11)25-20-14(21(29)30-3)8-13(18(23)19(20)24)9-26(31-4)17(28)10-32-12(2)27/h5-8,25H,9-10H2,1-4H3 |
| InChIKey | CKXWVLXVRCMLLA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|