C22H22F3N3O5 — CID 59348009
2-(4-ethynyl-2-fluoroanilino)-3,4-difluoro-N-(2-hydroxyethoxy)-5-[[methoxy(propanoyl)amino]methyl]benzamide (PubChem CID 59348009) has the molecular formula C22H22F3N3O5 and a molecular weight of 465.43 g/mol. Its IUPAC name is 2-(4-ethynyl-2-fluoroanilino)-3,4-difluoro-N-(2-hydroxyethoxy)-5-[[methoxy(propanoyl)amino]methyl]benzamide.
| Compound Name | 2-(4-ethynyl-2-fluoroanilino)-3,4-difluoro-N-(2-hydroxyethoxy)-5-[[methoxy(propanoyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 59348009 |
| Molecular Formula | C22H22F3N3O5 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-(4-ethynyl-2-fluoroanilino)-3,4-difluoro-N-(2-hydroxyethoxy)-5-[[methoxy(propanoyl)amino]methyl]benzamide |
| SMILES | C#Cc1ccc(Nc2c(C(=O)NOCCO)cc(CN(OC)C(=O)CC)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C22H22F3N3O5/c1-4-13-6-7-17(16(23)10-13)26-21-15(22(31)27-33-9-8-29)11-14(19(24)20(21)25)12-28(32-3)18(30)5-2/h1,6-7,10-11,26,29H,5,8-9,12H2,2-3H3,(H,27,31) |
| InChIKey | RJLQTPYRHSOPEK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|