C22H22F3N3O3S2 — CID 143173129
5-[[acetyl(ethyl)amino]sulfanylmethyl]-2-(4-ethynyl-2-fluoroanilino)-3,4-difluoro-N-(2-hydroxyethylsulfanyl)benzamide (PubChem CID 143173129) has the molecular formula C22H22F3N3O3S2 and a molecular weight of 497.56 g/mol. Its IUPAC name is 5-[[acetyl(ethyl)amino]sulfanylmethyl]-2-(4-ethynyl-2-fluoroanilino)-3,4-difluoro-N-(2-hydroxyethylsulfanyl)benzamide.
| Compound Name | 5-[[acetyl(ethyl)amino]sulfanylmethyl]-2-(4-ethynyl-2-fluoroanilino)-3,4-difluoro-N-(2-hydroxyethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 143173129 |
| Molecular Formula | C22H22F3N3O3S2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 5-[[acetyl(ethyl)amino]sulfanylmethyl]-2-(4-ethynyl-2-fluoroanilino)-3,4-difluoro-N-(2-hydroxyethylsulfanyl)benzamide |
| SMILES | C#Cc1ccc(Nc2c(C(=O)NSCCO)cc(CSN(CC)C(C)=O)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C22H22F3N3O3S2/c1-4-14-6-7-18(17(23)10-14)26-21-16(22(31)27-32-9-8-29)11-15(19(24)20(21)25)12-33-28(5-2)13(3)30/h1,6-7,10-11,26,29H,5,8-9,12H2,2-3H3,(H,27,31) |
| InChIKey | DHJYPOOGVBWJJS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|