C19H18FN3O4 — CID 143636140
3-(4-ethynyl-2-fluoroanilino)furo[3,2-c]pyridine-2-carboxamide;propane-1,3-diol (PubChem CID 143636140) has the molecular formula C19H18FN3O4 and a molecular weight of 371.37 g/mol. Its IUPAC name is 3-(4-ethynyl-2-fluoroanilino)furo[3,2-c]pyridine-2-carboxamide;propane-1,3-diol.
| Compound Name | 3-(4-ethynyl-2-fluoroanilino)furo[3,2-c]pyridine-2-carboxamide;propane-1,3-diol |
|---|---|
| PubChem CID | 143636140 |
| Molecular Formula | C19H18FN3O4 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-(4-ethynyl-2-fluoroanilino)furo[3,2-c]pyridine-2-carboxamide;propane-1,3-diol |
| SMILES | C#Cc1ccc(Nc2c(C(N)=O)oc3ccncc23)c(F)c1.OCCCO |
| InChI | InChI=1S/C16H10FN3O2.C3H8O2/c1-2-9-3-4-12(11(17)7-9)20-14-10-8-19-6-5-13(10)22-15(14)16(18)21;4-2-1-3-5/h1,3-8,20H,(H2,18,21);4-5H,1-3H2 |
| InChIKey | JFHWUXLBGHAMBU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|