C20H24FN3O4 — CID 143636209
ethane;3-(2-fluoro-4-methylanilino)-N-(2-hydroxypropoxy)furo[3,2-c]pyridine-2-carboxamide (PubChem CID 143636209) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is ethane;3-(2-fluoro-4-methylanilino)-N-(2-hydroxypropoxy)furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | ethane;3-(2-fluoro-4-methylanilino)-N-(2-hydroxypropoxy)furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143636209 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | ethane;3-(2-fluoro-4-methylanilino)-N-(2-hydroxypropoxy)furo[3,2-c]pyridine-2-carboxamide |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)NOCC(C)O)oc3ccncc23)c(F)c1 |
| InChI | InChI=1S/C18H18FN3O4.C2H6/c1-10-3-4-14(13(19)7-10)21-16-12-8-20-6-5-15(12)26-17(16)18(24)22-25-9-11(2)23;1-2/h3-8,11,21,23H,9H2,1-2H3,(H,22,24);1-2H3 |
| InChIKey | QWFXTJSEILIESE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|