C16H13BrFN3O4 — CID 25013474
3-(4-bromo-2-fluoroanilino)-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2-carboxamide (PubChem CID 25013474) has the molecular formula C16H13BrFN3O4 and a molecular weight of 410.20 g/mol. Its IUPAC name is 3-(4-bromo-2-fluoroanilino)-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-(4-bromo-2-fluoroanilino)-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25013474 |
| Molecular Formula | C16H13BrFN3O4 |
| Molecular Weight | 410.20 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 3-(4-bromo-2-fluoroanilino)-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NOCCO)c1oc2ccncc2c1Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C16H13BrFN3O4/c17-9-1-2-12(11(18)7-9)20-14-10-8-19-4-3-13(10)25-15(14)16(23)21-24-6-5-22/h1-4,7-8,20,22H,5-6H2,(H,21,23) |
| InChIKey | DWVXICZRQULBNA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|