C17H14F2IN3O4 — CID 88885981
3-(2,5-difluoro-4-iodoanilino)-N-(3-hydroxypropoxy)furo[3,2-c]pyridine-2-carboxamide (PubChem CID 88885981) has the molecular formula C17H14F2IN3O4 and a molecular weight of 489.22 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-iodoanilino)-N-(3-hydroxypropoxy)furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-(2,5-difluoro-4-iodoanilino)-N-(3-hydroxypropoxy)furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 88885981 |
| Molecular Formula | C17H14F2IN3O4 |
| Molecular Weight | 489.22 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | 3-(2,5-difluoro-4-iodoanilino)-N-(3-hydroxypropoxy)furo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NOCCCO)c1oc2ccncc2c1Nc1cc(F)c(I)cc1F |
| InChI | InChI=1S/C17H14F2IN3O4/c18-10-7-13(11(19)6-12(10)20)22-15-9-8-21-3-2-14(9)27-16(15)17(25)23-26-5-1-4-24/h2-3,6-8,22,24H,1,4-5H2,(H,23,25) |
| InChIKey | SNXWEEWOEVSEFQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|