C18H17FIN3O3 — CID 59704658
3-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropyl)-N-methylfuro[3,2-c]pyridine-2-carboxamide (PubChem CID 59704658) has the molecular formula C18H17FIN3O3 and a molecular weight of 469.25 g/mol. Its IUPAC name is 3-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropyl)-N-methylfuro[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropyl)-N-methylfuro[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59704658 |
| Molecular Formula | C18H17FIN3O3 |
| Molecular Weight | 469.25 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 3-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropyl)-N-methylfuro[3,2-c]pyridine-2-carboxamide |
| SMILES | CN(CCCO)C(=O)c1oc2ccncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C18H17FIN3O3/c1-23(7-2-8-24)18(25)17-16(12-10-21-6-5-15(12)26-17)22-14-4-3-11(20)9-13(14)19/h3-6,9-10,22,24H,2,7-8H2,1H3 |
| InChIKey | UCLIECUVCQUGMI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|