C14H7BrF2N2O3 — CID 151410687
3-(4-bromo-2,5-difluoroanilino)furo[3,2-c]pyridine-2-carboxylic acid (PubChem CID 151410687) has the molecular formula C14H7BrF2N2O3 and a molecular weight of 369.12 g/mol. Its IUPAC name is 3-(4-bromo-2,5-difluoroanilino)furo[3,2-c]pyridine-2-carboxylic acid.
| Compound Name | 3-(4-bromo-2,5-difluoroanilino)furo[3,2-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 151410687 |
| Molecular Formula | C14H7BrF2N2O3 |
| Molecular Weight | 369.12 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 3-(4-bromo-2,5-difluoroanilino)furo[3,2-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1oc2ccncc2c1Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C14H7BrF2N2O3/c15-7-3-9(17)10(4-8(7)16)19-12-6-5-18-2-1-11(6)22-13(12)14(20)21/h1-5,19H,(H,20,21) |
| InChIKey | OYLNDKYXUZGGHA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.12 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|