C18H14BF2N3O3 — CID 88886020
CID 88886020 (PubChem CID 88886020) has the molecular formula C18H14BF2N3O3 and a molecular weight of 369.14 g/mol.
| Compound Name | CID 88886020 |
|---|---|
| PubChem CID | 88886020 |
| Molecular Formula | C18H14BF2N3O3 |
| Molecular Weight | 369.14 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)c(Nc2c(C(=O)N3CC[C@@H](O)C3)oc3ccncc23)cc1F |
| InChI | InChI=1S/C18H14BF2N3O3/c19-11-5-13(21)14(6-12(11)20)23-16-10-7-22-3-1-15(10)27-17(16)18(26)24-4-2-9(25)8-24/h1,3,5-7,9,23,25H,2,4,8H2/t9-/m1/s1 |
| InChIKey | UFPBREZNAUMBDG-SECBINFHSA-N |
| XLogP | 1.85 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.14 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|