C17H14FIN4O3 — CID 25013799
N-(azetidin-3-yloxy)-3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridine-2-carboxamide (PubChem CID 25013799) has the molecular formula C17H14FIN4O3 and a molecular weight of 468.23 g/mol. Its IUPAC name is N-(azetidin-3-yloxy)-3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-(azetidin-3-yloxy)-3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25013799 |
| Molecular Formula | C17H14FIN4O3 |
| Molecular Weight | 468.23 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | N-(azetidin-3-yloxy)-3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NOC1CNC1)c1oc2ccncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C17H14FIN4O3/c18-12-5-9(19)1-2-13(12)22-15-11-8-20-4-3-14(11)25-16(15)17(24)23-26-10-6-21-7-10/h1-5,8,10,21-22H,6-7H2,(H,23,24) |
| InChIKey | LVBMSDYLFIKCSK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|