C21H23FIN5O4 — CID 160811478
3-(2-fluoro-4-iodoanilino)-1-methyl-N-piperidin-4-yloxypyrrolo[3,2-c]pyridine-2-carboxamide;formic acid (PubChem CID 160811478) has the molecular formula C21H23FIN5O4 and a molecular weight of 555.35 g/mol. Its IUPAC name is 3-(2-fluoro-4-iodoanilino)-1-methyl-N-piperidin-4-yloxypyrrolo[3,2-c]pyridine-2-carboxamide;formic acid.
| Compound Name | 3-(2-fluoro-4-iodoanilino)-1-methyl-N-piperidin-4-yloxypyrrolo[3,2-c]pyridine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 160811478 |
| Molecular Formula | C21H23FIN5O4 |
| Molecular Weight | 555.35 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | 3-(2-fluoro-4-iodoanilino)-1-methyl-N-piperidin-4-yloxypyrrolo[3,2-c]pyridine-2-carboxamide;formic acid |
| SMILES | Cn1c(C(=O)NOC2CCNCC2)c(Nc2ccc(I)cc2F)c2cnccc21.O=CO |
| InChI | InChI=1S/C20H21FIN5O2.CH2O2/c1-27-17-6-9-24-11-14(17)18(25-16-3-2-12(22)10-15(16)21)19(27)20(28)26-29-13-4-7-23-8-5-13;2-1-3/h2-3,6,9-11,13,23,25H,4-5,7-8H2,1H3,(H,26,28);1H,(H,2,3) |
| InChIKey | SEIVCNXLHFEVIU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|