C15H11FIN3O2 — CID 59596445
3-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[3,2-c]pyridine-2-carboxylic acid (PubChem CID 59596445) has the molecular formula C15H11FIN3O2 and a molecular weight of 411.17 g/mol. Its IUPAC name is 3-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[3,2-c]pyridine-2-carboxylic acid.
| Compound Name | 3-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[3,2-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59596445 |
| Molecular Formula | C15H11FIN3O2 |
| Molecular Weight | 411.17 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 3-(2-fluoro-4-iodoanilino)-1-methylpyrrolo[3,2-c]pyridine-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)c(Nc2ccc(I)cc2F)c2cnccc21 |
| InChI | InChI=1S/C15H11FIN3O2/c1-20-12-4-5-18-7-9(12)13(14(20)15(21)22)19-11-3-2-8(17)6-10(11)16/h2-7,19H,1H3,(H,21,22) |
| InChIKey | DVANICZDHGCUSA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|