C20H24FN3O2Si — CID 59596497
ethyl 3-(2-fluoro-4-trimethylsilylanilino)-1-methylpyrrolo[3,2-c]pyridine-2-carboxylate (PubChem CID 59596497) has the molecular formula C20H24FN3O2Si and a molecular weight of 385.52 g/mol. Its IUPAC name is ethyl 3-(2-fluoro-4-trimethylsilylanilino)-1-methylpyrrolo[3,2-c]pyridine-2-carboxylate.
| Compound Name | ethyl 3-(2-fluoro-4-trimethylsilylanilino)-1-methylpyrrolo[3,2-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59596497 |
| Molecular Formula | C20H24FN3O2Si |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | ethyl 3-(2-fluoro-4-trimethylsilylanilino)-1-methylpyrrolo[3,2-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccc([Si](C)(C)C)cc2F)c2cnccc2n1C |
| InChI | InChI=1S/C20H24FN3O2Si/c1-6-26-20(25)19-18(14-12-22-10-9-17(14)24(19)2)23-16-8-7-13(11-15(16)21)27(3,4)5/h7-12,23H,6H2,1-5H3 |
| InChIKey | VDMOCTFGWUEFAR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|