C19H20F2N2O3Si — CID 59704610
ethyl 7-fluoro-3-(2-fluoro-4-trimethylsilylanilino)furo[3,2-c]pyridine-2-carboxylate (PubChem CID 59704610) has the molecular formula C19H20F2N2O3Si and a molecular weight of 390.46 g/mol. Its IUPAC name is ethyl 7-fluoro-3-(2-fluoro-4-trimethylsilylanilino)furo[3,2-c]pyridine-2-carboxylate.
| Compound Name | ethyl 7-fluoro-3-(2-fluoro-4-trimethylsilylanilino)furo[3,2-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59704610 |
| Molecular Formula | C19H20F2N2O3Si |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | ethyl 7-fluoro-3-(2-fluoro-4-trimethylsilylanilino)furo[3,2-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1oc2c(F)cncc2c1Nc1ccc([Si](C)(C)C)cc1F |
| InChI | InChI=1S/C19H20F2N2O3Si/c1-5-25-19(24)18-16(12-9-22-10-14(21)17(12)26-18)23-15-7-6-11(8-13(15)20)27(2,3)4/h6-10,23H,5H2,1-4H3 |
| InChIKey | OADMIBKWTJUNDN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|