C22H16FIN2O3 — CID 59704680
ethyl 3-(2-fluoro-4-iodoanilino)-7-phenylfuro[3,2-c]pyridine-2-carboxylate (PubChem CID 59704680) has the molecular formula C22H16FIN2O3 and a molecular weight of 502.28 g/mol. Its IUPAC name is ethyl 3-(2-fluoro-4-iodoanilino)-7-phenylfuro[3,2-c]pyridine-2-carboxylate.
| Compound Name | ethyl 3-(2-fluoro-4-iodoanilino)-7-phenylfuro[3,2-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59704680 |
| Molecular Formula | C22H16FIN2O3 |
| Molecular Weight | 502.28 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | ethyl 3-(2-fluoro-4-iodoanilino)-7-phenylfuro[3,2-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1oc2c(-c3ccccc3)cncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C22H16FIN2O3/c1-2-28-22(27)21-19(26-18-9-8-14(24)10-17(18)23)16-12-25-11-15(20(16)29-21)13-6-4-3-5-7-13/h3-12,26H,2H2,1H3 |
| InChIKey | LAPANZLBYWWVSI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.28 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|