C15H11FIN3O3 — CID 59704595
ethyl 5-(2-fluoro-4-iodoanilino)furo[2,3-d]pyrimidine-6-carboxylate (PubChem CID 59704595) has the molecular formula C15H11FIN3O3 and a molecular weight of 427.17 g/mol. Its IUPAC name is ethyl 5-(2-fluoro-4-iodoanilino)furo[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-(2-fluoro-4-iodoanilino)furo[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 59704595 |
| Molecular Formula | C15H11FIN3O3 |
| Molecular Weight | 427.17 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | ethyl 5-(2-fluoro-4-iodoanilino)furo[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1oc2ncncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H11FIN3O3/c1-2-22-15(21)13-12(9-6-18-7-19-14(9)23-13)20-11-4-3-8(17)5-10(11)16/h3-7,20H,2H2,1H3 |
| InChIKey | KBWPYYQARSNBDT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|