C16H12F2IN3O5 — CID 87407476
[7-fluoro-3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-hydroxyethoxy)carbamate (PubChem CID 87407476) has the molecular formula C16H12F2IN3O5 and a molecular weight of 491.19 g/mol. Its IUPAC name is [7-fluoro-3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-hydroxyethoxy)carbamate.
| Compound Name | [7-fluoro-3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-hydroxyethoxy)carbamate |
|---|---|
| PubChem CID | 87407476 |
| Molecular Formula | C16H12F2IN3O5 |
| Molecular Weight | 491.19 g/mol |
| Exact Mass | 490.98 |
| IUPAC Name | [7-fluoro-3-(2-fluoro-4-iodoanilino)furo[3,2-c]pyridin-2-yl] N-(2-hydroxyethoxy)carbamate |
| SMILES | O=C(NOCCO)Oc1oc2c(F)cncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H12F2IN3O5/c17-10-5-8(19)1-2-12(10)21-13-9-6-20-7-11(18)14(9)26-15(13)27-16(24)22-25-4-3-23/h1-2,5-7,21,23H,3-4H2,(H,22,24) |
| InChIKey | NIHAWDVSASHHKO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|