C18H15FIN5O3 — CID 88932158
7-cyano-3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 88932158) has the molecular formula C18H15FIN5O3 and a molecular weight of 495.25 g/mol. Its IUPAC name is 7-cyano-3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 7-cyano-3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 88932158 |
| Molecular Formula | C18H15FIN5O3 |
| Molecular Weight | 495.25 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 7-cyano-3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | Cn1c(C(=O)NOCCO)c(Nc2ccc(I)cc2F)c2cncc(C#N)c21 |
| InChI | InChI=1S/C18H15FIN5O3/c1-25-16-10(7-21)8-22-9-12(16)15(17(25)18(27)24-28-5-4-26)23-14-3-2-11(20)6-13(14)19/h2-3,6,8-9,23,26H,4-5H2,1H3,(H,24,27) |
| InChIKey | QTWPMMHMLXAKAX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|