C17H16ClIN4O3 — CID 59596564
3-(2-chloro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 59596564) has the molecular formula C17H16ClIN4O3 and a molecular weight of 486.70 g/mol. Its IUPAC name is 3-(2-chloro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-(2-chloro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59596564 |
| Molecular Formula | C17H16ClIN4O3 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | 3-(2-chloro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-methylpyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | Cn1c(C(=O)NOCCO)c(Nc2ccc(I)cc2Cl)c2cnccc21 |
| InChI | InChI=1S/C17H16ClIN4O3/c1-23-14-4-5-20-9-11(14)15(16(23)17(25)22-26-7-6-24)21-13-3-2-10(19)8-12(13)18/h2-5,8-9,21,24H,6-7H2,1H3,(H,22,25) |
| InChIKey | XJDQUYHFKVIGOC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|