C27H28F4N4O3 — CID 143686691
ethane;3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 143686691) has the molecular formula C27H28F4N4O3 and a molecular weight of 532.54 g/mol. Its IUPAC name is ethane;3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | ethane;3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143686691 |
| Molecular Formula | C27H28F4N4O3 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | ethane;3-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)NOCCO)n(Cc3cccc(C(F)(F)F)c3)c3ccncc23)c(F)c1 |
| InChI | InChI=1S/C25H22F4N4O3.C2H6/c1-15-5-6-20(19(26)11-15)31-22-18-13-30-8-7-21(18)33(23(22)24(35)32-36-10-9-34)14-16-3-2-4-17(12-16)25(27,28)29;1-2/h2-8,11-13,31,34H,9-10,14H2,1H3,(H,32,35);1-2H3 |
| InChIKey | QKMIGQINGKSBHM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|