C26H30FN5O3S — CID 143686666
ethane;5-[[3-(2-fluoro-4-methylanilino)-2-formylpyrrolo[3,2-c]pyridin-1-yl]methyl]thiophene-2-carbonitrile;2-(methylaminooxy)ethanol (PubChem CID 143686666) has the molecular formula C26H30FN5O3S and a molecular weight of 511.62 g/mol. Its IUPAC name is ethane;5-[[3-(2-fluoro-4-methylanilino)-2-formylpyrrolo[3,2-c]pyridin-1-yl]methyl]thiophene-2-carbonitrile;2-(methylaminooxy)ethanol.
| Compound Name | ethane;5-[[3-(2-fluoro-4-methylanilino)-2-formylpyrrolo[3,2-c]pyridin-1-yl]methyl]thiophene-2-carbonitrile;2-(methylaminooxy)ethanol |
|---|---|
| PubChem CID | 143686666 |
| Molecular Formula | C26H30FN5O3S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | ethane;5-[[3-(2-fluoro-4-methylanilino)-2-formylpyrrolo[3,2-c]pyridin-1-yl]methyl]thiophene-2-carbonitrile;2-(methylaminooxy)ethanol |
| SMILES | CC.CNOCCO.Cc1ccc(Nc2c(C=O)n(Cc3ccc(C#N)s3)c3ccncc23)c(F)c1 |
| InChI | InChI=1S/C21H15FN4OS.C3H9NO2.C2H6/c1-13-2-5-18(17(22)8-13)25-21-16-10-24-7-6-19(16)26(20(21)12-27)11-15-4-3-14(9-23)28-15;1-4-6-3-2-5;1-2/h2-8,10,12,25H,11H2,1H3;4-5H,2-3H2,1H3;1-2H3 |
| InChIKey | PXFUNWXASOXADU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|