C16H14F2N4O3 — CID 166940184
6-cyano-5-fluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyridine-3-carboxamide (PubChem CID 166940184) has the molecular formula C16H14F2N4O3 and a molecular weight of 348.31 g/mol. Its IUPAC name is 6-cyano-5-fluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyridine-3-carboxamide.
| Compound Name | 6-cyano-5-fluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166940184 |
| Molecular Formula | C16H14F2N4O3 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 6-cyano-5-fluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)pyridine-3-carboxamide |
| SMILES | Cc1ccc(Nc2nc(C#N)c(F)cc2C(=O)NOCCO)c(F)c1 |
| InChI | InChI=1S/C16H14F2N4O3/c1-9-2-3-13(11(17)6-9)20-15-10(16(24)22-25-5-4-23)7-12(18)14(8-19)21-15/h2-3,6-7,23H,4-5H2,1H3,(H,20,21)(H,22,24) |
| InChIKey | LHYYRCKZDOLBHO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|